C10H12FNO3S — CID 115336470
(1,1-dioxothiolan-3-yl)-(5-fluoro-3-pyridinyl)methanol (PubChem CID 115336470) has the molecular formula C10H12FNO3S and a molecular weight of 245.27 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-(5-fluoro-3-pyridinyl)methanol.
| Compound Name | (1,1-dioxothiolan-3-yl)-(5-fluoro-3-pyridinyl)methanol |
|---|---|
| PubChem CID | 115336470 |
| Molecular Formula | C10H12FNO3S |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-(5-fluoro-3-pyridinyl)methanol |
| SMILES | O=S1(=O)CCC(C(O)c2cncc(F)c2)C1 |
| InChI | InChI=1S/C10H12FNO3S/c11-9-3-8(4-12-5-9)10(13)7-1-2-16(14,15)6-7/h3-5,7,10,13H,1-2,6H2 |
| InChIKey | DIXQCKPXLVWBSK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |