C9H13NO3S — CID 64905807
(1,1-dioxothiolan-3-yl)-(1H-pyrrol-3-yl)methanol (PubChem CID 64905807) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-(1H-pyrrol-3-yl)methanol.
| Compound Name | (1,1-dioxothiolan-3-yl)-(1H-pyrrol-3-yl)methanol |
|---|---|
| PubChem CID | 64905807 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-(1H-pyrrol-3-yl)methanol |
| SMILES | O=S1(=O)CCC(C(O)c2cc[nH]c2)C1 |
| InChI | InChI=1S/C9H13NO3S/c11-9(7-1-3-10-5-7)8-2-4-14(12,13)6-8/h1,3,5,8-11H,2,4,6H2 |
| InChIKey | PKVBLVQZZDAPSA-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |