C11H12BrClO3S — CID 83230480
(3-bromo-4-chlorophenyl)-(1,1-dioxothiolan-3-yl)methanol (PubChem CID 83230480) has the molecular formula C11H12BrClO3S and a molecular weight of 339.64 g/mol. Its IUPAC name is (3-bromo-4-chlorophenyl)-(1,1-dioxothiolan-3-yl)methanol.
| Compound Name | (3-bromo-4-chlorophenyl)-(1,1-dioxothiolan-3-yl)methanol |
|---|---|
| PubChem CID | 83230480 |
| Molecular Formula | C11H12BrClO3S |
| Molecular Weight | 339.64 g/mol |
| Exact Mass | 337.94 |
| IUPAC Name | (3-bromo-4-chlorophenyl)-(1,1-dioxothiolan-3-yl)methanol |
| SMILES | O=S1(=O)CCC(C(O)c2ccc(Cl)c(Br)c2)C1 |
| InChI | InChI=1S/C11H12BrClO3S/c12-9-5-7(1-2-10(9)13)11(14)8-3-4-17(15,16)6-8/h1-2,5,8,11,14H,3-4,6H2 |
| InChIKey | IQPXHEGJPRFQBY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.64 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |