C13H17BrClNO2S — CID 83230319
N-[(3-bromo-4-chlorophenyl)-(1,1-dioxothiolan-3-yl)methyl]ethanamine (PubChem CID 83230319) has the molecular formula C13H17BrClNO2S and a molecular weight of 366.71 g/mol. Its IUPAC name is N-[(3-bromo-4-chlorophenyl)-(1,1-dioxothiolan-3-yl)methyl]ethanamine.
| Compound Name | N-[(3-bromo-4-chlorophenyl)-(1,1-dioxothiolan-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 83230319 |
| Molecular Formula | C13H17BrClNO2S |
| Molecular Weight | 366.71 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | N-[(3-bromo-4-chlorophenyl)-(1,1-dioxothiolan-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(Cl)c(Br)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17BrClNO2S/c1-2-16-13(10-5-6-19(17,18)8-10)9-3-4-12(15)11(14)7-9/h3-4,7,10,13,16H,2,5-6,8H2,1H3 |
| InChIKey | PTLZWOYDXXWSIY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.71 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |