C17H25BrClN — CID 115567623
N-[(3-bromo-4-chlorophenyl)-(3-ethylcyclohexyl)methyl]ethanamine (PubChem CID 115567623) has the molecular formula C17H25BrClN and a molecular weight of 358.75 g/mol. Its IUPAC name is N-[(3-bromo-4-chlorophenyl)-(3-ethylcyclohexyl)methyl]ethanamine.
| Compound Name | N-[(3-bromo-4-chlorophenyl)-(3-ethylcyclohexyl)methyl]ethanamine |
|---|---|
| PubChem CID | 115567623 |
| Molecular Formula | C17H25BrClN |
| Molecular Weight | 358.75 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-[(3-bromo-4-chlorophenyl)-(3-ethylcyclohexyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(Cl)c(Br)c1)C1CCCC(CC)C1 |
| InChI | InChI=1S/C17H25BrClN/c1-3-12-6-5-7-13(10-12)17(20-4-2)14-8-9-16(19)15(18)11-14/h8-9,11-13,17,20H,3-7,10H2,1-2H3 |
| InChIKey | VRADJDCYTAHWLD-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.75 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |