C15H20O3S — CID 116505854
(4-cyclobutylphenyl)-(1,1-dioxothiolan-3-yl)methanol (PubChem CID 116505854) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is (4-cyclobutylphenyl)-(1,1-dioxothiolan-3-yl)methanol.
| Compound Name | (4-cyclobutylphenyl)-(1,1-dioxothiolan-3-yl)methanol |
|---|---|
| PubChem CID | 116505854 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (4-cyclobutylphenyl)-(1,1-dioxothiolan-3-yl)methanol |
| SMILES | O=S1(=O)CCC(C(O)c2ccc(C3CCC3)cc2)C1 |
| InChI | InChI=1S/C15H20O3S/c16-15(14-8-9-19(17,18)10-14)13-6-4-12(5-7-13)11-2-1-3-11/h4-7,11,14-16H,1-3,8-10H2 |
| InChIKey | FGNACTIMKNUHQZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |