C13H19NO3S — CID 115050223
[4-(aminomethyl)phenyl]-(1,1-dioxothian-4-yl)methanol (PubChem CID 115050223) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is [4-(aminomethyl)phenyl]-(1,1-dioxothian-4-yl)methanol.
| Compound Name | [4-(aminomethyl)phenyl]-(1,1-dioxothian-4-yl)methanol |
|---|---|
| PubChem CID | 115050223 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | [4-(aminomethyl)phenyl]-(1,1-dioxothian-4-yl)methanol |
| SMILES | NCc1ccc(C(O)C2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C13H19NO3S/c14-9-10-1-3-11(4-2-10)13(15)12-5-7-18(16,17)8-6-12/h1-4,12-13,15H,5-9,14H2 |
| InChIKey | NHMTXXCIACFMEA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |