C11H14O4S — CID 115044716
4-[(1,1-dioxothiolan-3-yl)-hydroxymethyl]phenol (PubChem CID 115044716) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)-hydroxymethyl]phenol.
| Compound Name | 4-[(1,1-dioxothiolan-3-yl)-hydroxymethyl]phenol |
|---|---|
| PubChem CID | 115044716 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 4-[(1,1-dioxothiolan-3-yl)-hydroxymethyl]phenol |
| SMILES | O=S1(=O)CCC(C(O)c2ccc(O)cc2)C1 |
| InChI | InChI=1S/C11H14O4S/c12-10-3-1-8(2-4-10)11(13)9-5-6-16(14,15)7-9/h1-4,9,11-13H,5-7H2 |
| InChIKey | CIOHKYZALTZLHS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |