C13H15NO4S — CID 64905806
5-[(1,1-dioxothiolan-3-yl)-hydroxymethyl]-1,3-dihydroindol-2-one (PubChem CID 64905806) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 5-[(1,1-dioxothiolan-3-yl)-hydroxymethyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[(1,1-dioxothiolan-3-yl)-hydroxymethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 64905806 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 5-[(1,1-dioxothiolan-3-yl)-hydroxymethyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(O)C3CCS(=O)(=O)C3)ccc2N1 |
| InChI | InChI=1S/C13H15NO4S/c15-12-6-10-5-8(1-2-11(10)14-12)13(16)9-3-4-19(17,18)7-9/h1-2,5,9,13,16H,3-4,6-7H2,(H,14,15) |
| InChIKey | ZWOCDJRDHFJTJH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |