C17H24O3S — CID 64906015
(4-cyclohexylphenyl)-(1,1-dioxothiolan-3-yl)methanol (PubChem CID 64906015) has the molecular formula C17H24O3S and a molecular weight of 308.44 g/mol. Its IUPAC name is (4-cyclohexylphenyl)-(1,1-dioxothiolan-3-yl)methanol.
| Compound Name | (4-cyclohexylphenyl)-(1,1-dioxothiolan-3-yl)methanol |
|---|---|
| PubChem CID | 64906015 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (4-cyclohexylphenyl)-(1,1-dioxothiolan-3-yl)methanol |
| SMILES | O=S1(=O)CCC(C(O)c2ccc(C3CCCCC3)cc2)C1 |
| InChI | InChI=1S/C17H24O3S/c18-17(16-10-11-21(19,20)12-16)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h6-9,13,16-18H,1-5,10-12H2 |
| InChIKey | ZDWCNKFSWORVKK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |