About (5-fluoro-3-pyridinyl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol
(5-fluoro-3-pyridinyl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol (PubChem CID 114097414) has the molecular formula C14H16FNO
and a molecular weight of 233.29 g/mol. Its IUPAC name is (5-fluoro-3-pyridinyl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol.
Molecular Properties
| Compound Name | (5-fluoro-3-pyridinyl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol |
| PubChem CID | 114097414 |
| Molecular Formula | C14H16FNO |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (5-fluoro-3-pyridinyl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol |
| SMILES | OC(c1cncc(F)c1)C1C2C3CCC(C3)C21 |
| InChI | InChI=1S/C14H16FNO/c15-10-4-9(5-16-6-10)14(17)13-11-7-1-2-8(3-7)12(11)13/h4-8,11-14,17H,1-3H2 |
| InChIKey | JEZZLQPLPJPXBB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-fluoro-3-pyridinyl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-3-pyridinyl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol?
The IUPAC name of (5-fluoro-3-pyridinyl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol (CID 114097414) is (5-fluoro-3-pyridinyl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol.
What is the SMILES notation for (5-fluoro-3-pyridinyl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol?
The canonical SMILES for (5-fluoro-3-pyridinyl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol is OC(c1cncc(F)c1)C1C2C3CCC(C3)C21.
What is the InChIKey of (5-fluoro-3-pyridinyl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol?
The InChIKey is JEZZLQPLPJPXBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FNO/c15-10-4-9(5-16-6-10)14(17)13-11-7-1-2-8(3-7)12(11)13/h4-8,11-14,17H,1-3H2.
What are the key properties of (5-fluoro-3-pyridinyl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol?
(5-fluoro-3-pyridinyl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol has a molecular weight of 233.29 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-3-pyridinyl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol is sourced from PubChem (CID 114097414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).