C10H12FNO3 — CID 103547374
2-(1,3-dioxolan-2-yl)-1-(5-fluoro-3-pyridinyl)ethanol (PubChem CID 103547374) has the molecular formula C10H12FNO3 and a molecular weight of 213.21 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-yl)-1-(5-fluoro-3-pyridinyl)ethanol.
| Compound Name | 2-(1,3-dioxolan-2-yl)-1-(5-fluoro-3-pyridinyl)ethanol |
|---|---|
| PubChem CID | 103547374 |
| Molecular Formula | C10H12FNO3 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 2-(1,3-dioxolan-2-yl)-1-(5-fluoro-3-pyridinyl)ethanol |
| SMILES | OC(CC1OCCO1)c1cncc(F)c1 |
| InChI | InChI=1S/C10H12FNO3/c11-8-3-7(5-12-6-8)9(13)4-10-14-1-2-15-10/h3,5-6,9-10,13H,1-2,4H2 |
| InChIKey | AXJXPTZAUYWAII-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |