C10H13FN2O2 — CID 65352820
1,4-dioxan-2-yl-(5-fluoro-3-pyridinyl)methanamine (PubChem CID 65352820) has the molecular formula C10H13FN2O2 and a molecular weight of 212.22 g/mol. Its IUPAC name is 1,4-dioxan-2-yl-(5-fluoro-3-pyridinyl)methanamine.
| Compound Name | 1,4-dioxan-2-yl-(5-fluoro-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 65352820 |
| Molecular Formula | C10H13FN2O2 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 1,4-dioxan-2-yl-(5-fluoro-3-pyridinyl)methanamine |
| SMILES | NC(c1cncc(F)c1)C1COCCO1 |
| InChI | InChI=1S/C10H13FN2O2/c11-8-3-7(4-13-5-8)10(12)9-6-14-1-2-15-9/h3-5,9-10H,1-2,6,12H2 |
| InChIKey | OOKFCRVRDKCUEX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |