C11H16N2O2 — CID 65351256
1,4-dioxan-2-yl-(6-methyl-3-pyridinyl)methanamine (PubChem CID 65351256) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1,4-dioxan-2-yl-(6-methyl-3-pyridinyl)methanamine.
| Compound Name | 1,4-dioxan-2-yl-(6-methyl-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 65351256 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1,4-dioxan-2-yl-(6-methyl-3-pyridinyl)methanamine |
| SMILES | Cc1ccc(C(N)C2COCCO2)cn1 |
| InChI | InChI=1S/C11H16N2O2/c1-8-2-3-9(6-13-8)11(12)10-7-14-4-5-15-10/h2-3,6,10-11H,4-5,7,12H2,1H3 |
| InChIKey | GXQIRVZELFLOKF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |