C11H14FNO2 — CID 65351089
1,4-dioxan-2-yl-(3-fluorophenyl)methanamine (PubChem CID 65351089) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is 1,4-dioxan-2-yl-(3-fluorophenyl)methanamine.
| Compound Name | 1,4-dioxan-2-yl-(3-fluorophenyl)methanamine |
|---|---|
| PubChem CID | 65351089 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 1,4-dioxan-2-yl-(3-fluorophenyl)methanamine |
| SMILES | NC(c1cccc(F)c1)C1COCCO1 |
| InChI | InChI=1S/C11H14FNO2/c12-9-3-1-2-8(6-9)11(13)10-7-14-4-5-15-10/h1-3,6,10-11H,4-5,7,13H2 |
| InChIKey | BWTKCHATEGNXOK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |