C11H12BrFO2 — CID 62803315
2-[bromo-(4-fluorophenyl)methyl]-1,4-dioxane (PubChem CID 62803315) has the molecular formula C11H12BrFO2 and a molecular weight of 275.12 g/mol. Its IUPAC name is 2-[bromo-(4-fluorophenyl)methyl]-1,4-dioxane.
| Compound Name | 2-[bromo-(4-fluorophenyl)methyl]-1,4-dioxane |
|---|---|
| PubChem CID | 62803315 |
| Molecular Formula | C11H12BrFO2 |
| Molecular Weight | 275.12 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 2-[bromo-(4-fluorophenyl)methyl]-1,4-dioxane |
| SMILES | Fc1ccc(C(Br)C2COCCO2)cc1 |
| InChI | InChI=1S/C11H12BrFO2/c12-11(10-7-14-5-6-15-10)8-1-3-9(13)4-2-8/h1-4,10-11H,5-7H2 |
| InChIKey | DETOMLQRYWHXLA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.12 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|