C12H14F2O4S — CID 64904360
(2,6-difluoro-4-methoxyphenyl)-(1,1-dioxothiolan-3-yl)methanol (PubChem CID 64904360) has the molecular formula C12H14F2O4S and a molecular weight of 292.30 g/mol. Its IUPAC name is (2,6-difluoro-4-methoxyphenyl)-(1,1-dioxothiolan-3-yl)methanol.
| Compound Name | (2,6-difluoro-4-methoxyphenyl)-(1,1-dioxothiolan-3-yl)methanol |
|---|---|
| PubChem CID | 64904360 |
| Molecular Formula | C12H14F2O4S |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | (2,6-difluoro-4-methoxyphenyl)-(1,1-dioxothiolan-3-yl)methanol |
| SMILES | COc1cc(F)c(C(O)C2CCS(=O)(=O)C2)c(F)c1 |
| InChI | InChI=1S/C12H14F2O4S/c1-18-8-4-9(13)11(10(14)5-8)12(15)7-2-3-19(16,17)6-7/h4-5,7,12,15H,2-3,6H2,1H3 |
| InChIKey | IDKWNXZHJMXICL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |