C12H14F2O3S — CID 82823031
(2,6-difluoro-3-methylphenyl)-(1,1-dioxothiolan-3-yl)methanol (PubChem CID 82823031) has the molecular formula C12H14F2O3S and a molecular weight of 276.30 g/mol. Its IUPAC name is (2,6-difluoro-3-methylphenyl)-(1,1-dioxothiolan-3-yl)methanol.
| Compound Name | (2,6-difluoro-3-methylphenyl)-(1,1-dioxothiolan-3-yl)methanol |
|---|---|
| PubChem CID | 82823031 |
| Molecular Formula | C12H14F2O3S |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | (2,6-difluoro-3-methylphenyl)-(1,1-dioxothiolan-3-yl)methanol |
| SMILES | Cc1ccc(F)c(C(O)C2CCS(=O)(=O)C2)c1F |
| InChI | InChI=1S/C12H14F2O3S/c1-7-2-3-9(13)10(11(7)14)12(15)8-4-5-18(16,17)6-8/h2-3,8,12,15H,4-6H2,1H3 |
| InChIKey | RTDZMLWPNPCEDU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |