C12H16FNO2S — CID 115336531
(1,1-dioxothiolan-3-yl)-(5-fluoro-2-methylphenyl)methanamine (PubChem CID 115336531) has the molecular formula C12H16FNO2S and a molecular weight of 257.33 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-(5-fluoro-2-methylphenyl)methanamine.
| Compound Name | (1,1-dioxothiolan-3-yl)-(5-fluoro-2-methylphenyl)methanamine |
|---|---|
| PubChem CID | 115336531 |
| Molecular Formula | C12H16FNO2S |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-(5-fluoro-2-methylphenyl)methanamine |
| SMILES | Cc1ccc(F)cc1C(N)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H16FNO2S/c1-8-2-3-10(13)6-11(8)12(14)9-4-5-17(15,16)7-9/h2-3,6,9,12H,4-5,7,14H2,1H3 |
| InChIKey | BNBHZVSCMSQDSX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |