C12H15ClFNO2S — CID 65020242
2-(2-chloro-4-fluorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanamine (PubChem CID 65020242) has the molecular formula C12H15ClFNO2S and a molecular weight of 291.77 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanamine.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 65020242 |
| Molecular Formula | C12H15ClFNO2S |
| Molecular Weight | 291.77 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-1-(1,1-dioxothiolan-3-yl)ethanamine |
| SMILES | NC(Cc1ccc(F)cc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15ClFNO2S/c13-11-6-10(14)2-1-8(11)5-12(15)9-3-4-18(16,17)7-9/h1-2,6,9,12H,3-5,7,15H2 |
| InChIKey | AROBXGQAOBBCTQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.77 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |