C13H15Cl2FO2S — CID 66033743
3-[1-chloro-3-(2-chloro-4-fluorophenyl)propan-2-yl]thiolane 1,1-dioxide (PubChem CID 66033743) has the molecular formula C13H15Cl2FO2S and a molecular weight of 325.23 g/mol. Its IUPAC name is 3-[1-chloro-3-(2-chloro-4-fluorophenyl)propan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-chloro-3-(2-chloro-4-fluorophenyl)propan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 66033743 |
| Molecular Formula | C13H15Cl2FO2S |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 3-[1-chloro-3-(2-chloro-4-fluorophenyl)propan-2-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(CCl)Cc2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C13H15Cl2FO2S/c14-7-11(10-3-4-19(17,18)8-10)5-9-1-2-12(16)6-13(9)15/h1-2,6,10-11H,3-5,7-8H2 |
| InChIKey | YJERPAMWGUDQPW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|