C10H9F3O — CID 139965789
cyclopropyl-(2,3,6-trifluorophenyl)methanol (PubChem CID 139965789) has the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. Its IUPAC name is cyclopropyl-(2,3,6-trifluorophenyl)methanol.
| Compound Name | cyclopropyl-(2,3,6-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 139965789 |
| Molecular Formula | C10H9F3O |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | cyclopropyl-(2,3,6-trifluorophenyl)methanol |
| SMILES | OC(c1c(F)ccc(F)c1F)C1CC1 |
| InChI | InChI=1S/C10H9F3O/c11-6-3-4-7(12)9(13)8(6)10(14)5-1-2-5/h3-5,10,14H,1-2H2 |
| InChIKey | LMYDGLKSVNUYNA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|