C12H11F5O — CID 115840535
cyclopentyl-(2,3,4,5,6-pentafluorophenyl)methanol (PubChem CID 115840535) has the molecular formula C12H11F5O and a molecular weight of 266.21 g/mol. Its IUPAC name is cyclopentyl-(2,3,4,5,6-pentafluorophenyl)methanol.
| Compound Name | cyclopentyl-(2,3,4,5,6-pentafluorophenyl)methanol |
|---|---|
| PubChem CID | 115840535 |
| Molecular Formula | C12H11F5O |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | cyclopentyl-(2,3,4,5,6-pentafluorophenyl)methanol |
| SMILES | OC(c1c(F)c(F)c(F)c(F)c1F)C1CCCC1 |
| InChI | InChI=1S/C12H11F5O/c13-7-6(12(18)5-3-1-2-4-5)8(14)10(16)11(17)9(7)15/h5,12,18H,1-4H2 |
| InChIKey | UYMMFEUXMBREQK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|