C11H11ClF5NO — CID 171160472
(1S,2R)-2-amino-1-cyclopropyl-2-(2,3,4,5,6-pentafluorophenyl)ethanol;hydrochloride (PubChem CID 171160472) has the molecular formula C11H11ClF5NO and a molecular weight of 303.66 g/mol. Its IUPAC name is (1S,2R)-2-amino-1-cyclopropyl-2-(2,3,4,5,6-pentafluorophenyl)ethanol;hydrochloride.
| Compound Name | (1S,2R)-2-amino-1-cyclopropyl-2-(2,3,4,5,6-pentafluorophenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 171160472 |
| Molecular Formula | C11H11ClF5NO |
| Molecular Weight | 303.66 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | (1S,2R)-2-amino-1-cyclopropyl-2-(2,3,4,5,6-pentafluorophenyl)ethanol;hydrochloride |
| SMILES | Cl.N[C@H](c1c(F)c(F)c(F)c(F)c1F)[C@@H](O)C1CC1 |
| InChI | InChI=1S/C11H10F5NO.ClH/c12-5-4(10(17)11(18)3-1-2-3)6(13)8(15)9(16)7(5)14;/h3,10-11,18H,1-2,17H2;1H/t10-,11+;/m1./s1 |
| InChIKey | LAYGMZZHCMPHKY-DHXVBOOMSA-N |
| XLogP | 2.57 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.66 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|