C9H6ClF8NO — CID 171161915
(2S,3S)-3-amino-1,1,1-trifluoro-3-(2,3,4,5,6-pentafluorophenyl)propan-2-ol;hydrochloride (PubChem CID 171161915) has the molecular formula C9H6ClF8NO and a molecular weight of 331.59 g/mol. Its IUPAC name is (2S,3S)-3-amino-1,1,1-trifluoro-3-(2,3,4,5,6-pentafluorophenyl)propan-2-ol;hydrochloride.
| Compound Name | (2S,3S)-3-amino-1,1,1-trifluoro-3-(2,3,4,5,6-pentafluorophenyl)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171161915 |
| Molecular Formula | C9H6ClF8NO |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | (2S,3S)-3-amino-1,1,1-trifluoro-3-(2,3,4,5,6-pentafluorophenyl)propan-2-ol;hydrochloride |
| SMILES | Cl.N[C@@H](c1c(F)c(F)c(F)c(F)c1F)[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C9H5F8NO.ClH/c10-2-1(7(18)8(19)9(15,16)17)3(11)5(13)6(14)4(2)12;/h7-8,19H,18H2;1H/t7-,8-;/m0./s1 |
| InChIKey | TXMQOJOIBRQRLQ-WSZWBAFRSA-N |
| XLogP | 2.73 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|