C4H9ClF3NO — CID 24797122
(2R,3S)-3-amino-1,1,1-trifluorobutan-2-ol;hydrochloride (PubChem CID 24797122) has the molecular formula C4H9ClF3NO and a molecular weight of 179.57 g/mol. Its IUPAC name is (2R,3S)-3-amino-1,1,1-trifluorobutan-2-ol;hydrochloride.
| Compound Name | (2R,3S)-3-amino-1,1,1-trifluorobutan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 24797122 |
| Molecular Formula | C4H9ClF3NO |
| Molecular Weight | 179.57 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | (2R,3S)-3-amino-1,1,1-trifluorobutan-2-ol;hydrochloride |
| SMILES | C[C@H](N)[C@@H](O)C(F)(F)F.Cl |
| InChI | InChI=1S/C4H8F3NO.ClH/c1-2(8)3(9)4(5,6)7;/h2-3,9H,8H2,1H3;1H/t2-,3+;/m0./s1 |
| InChIKey | VFMKPKXHRNKGGM-LJUKVTEVSA-N |
| XLogP | 0.68 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.57 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |