C7H16F3N — CID 159945347
2-methylpropane;(2R)-1,1,1-trifluoropropan-2-amine (PubChem CID 159945347) has the molecular formula C7H16F3N and a molecular weight of 171.21 g/mol. Its IUPAC name is 2-methylpropane;(2R)-1,1,1-trifluoropropan-2-amine.
| Compound Name | 2-methylpropane;(2R)-1,1,1-trifluoropropan-2-amine |
|---|---|
| PubChem CID | 159945347 |
| Molecular Formula | C7H16F3N |
| Molecular Weight | 171.21 g/mol |
| Exact Mass | 171.12 |
| IUPAC Name | 2-methylpropane;(2R)-1,1,1-trifluoropropan-2-amine |
| SMILES | CC(C)C.C[C@@H](N)C(F)(F)F |
| InChI | InChI=1S/C4H10.C3H6F3N/c1-4(2)3;1-2(7)3(4,5)6/h4H,1-3H3;2H,7H2,1H3/t;2-/m.1/s1 |
| InChIKey | OBKHMJHBYQHKCH-ARGLLVQISA-N |
| XLogP | 2.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.21 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |