C7H14F3N — CID 122577413
(2S,3S)-1,1,1-trifluoro-3,4-dimethylpentan-2-amine (PubChem CID 122577413) has the molecular formula C7H14F3N and a molecular weight of 169.19 g/mol. Its IUPAC name is (2S,3S)-1,1,1-trifluoro-3,4-dimethylpentan-2-amine.
| Compound Name | (2S,3S)-1,1,1-trifluoro-3,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 122577413 |
| Molecular Formula | C7H14F3N |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (2S,3S)-1,1,1-trifluoro-3,4-dimethylpentan-2-amine |
| SMILES | CC(C)[C@H](C)[C@H](N)C(F)(F)F |
| InChI | InChI=1S/C7H14F3N/c1-4(2)5(3)6(11)7(8,9)10/h4-6H,11H2,1-3H3/t5-,6-/m0/s1 |
| InChIKey | ZZESVECTNFHZMB-WDSKDSINSA-N |
| XLogP | 2.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |