C6H12F3NO — CID 93492915
(2R,3S)-3-amino-1,1,1-trifluorohexan-2-ol (PubChem CID 93492915) has the molecular formula C6H12F3NO and a molecular weight of 171.16 g/mol. Its IUPAC name is (2R,3S)-3-amino-1,1,1-trifluorohexan-2-ol.
| Compound Name | (2R,3S)-3-amino-1,1,1-trifluorohexan-2-ol |
|---|---|
| PubChem CID | 93492915 |
| Molecular Formula | C6H12F3NO |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (2R,3S)-3-amino-1,1,1-trifluorohexan-2-ol |
| SMILES | CCC[C@H](N)[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C6H12F3NO/c1-2-3-4(10)5(11)6(7,8)9/h4-5,11H,2-3,10H2,1H3/t4-,5+/m0/s1 |
| InChIKey | ARBRDSKDRRVOTN-CRCLSJGQSA-N |
| XLogP | 1.04 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |