C8H15F3N2O2 — CID 86762421
(2S,3S)-3-amino-2-hydroxy-N-(2,2,2-trifluoroethyl)hexanamide (PubChem CID 86762421) has the molecular formula C8H15F3N2O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is (2S,3S)-3-amino-2-hydroxy-N-(2,2,2-trifluoroethyl)hexanamide.
| Compound Name | (2S,3S)-3-amino-2-hydroxy-N-(2,2,2-trifluoroethyl)hexanamide |
|---|---|
| PubChem CID | 86762421 |
| Molecular Formula | C8H15F3N2O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (2S,3S)-3-amino-2-hydroxy-N-(2,2,2-trifluoroethyl)hexanamide |
| SMILES | CCC[C@H](N)[C@H](O)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O2/c1-2-3-5(12)6(14)7(15)13-4-8(9,10)11/h5-6,14H,2-4,12H2,1H3,(H,13,15)/t5-,6-/m0/s1 |
| InChIKey | FYJZUELTGNGYKY-WDSKDSINSA-N |
| XLogP | 0.15 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |