C13H26N2O4 — CID 142110693
ethane;prop-2-enyl 2-[(3-amino-2-hydroxyhexanoyl)amino]acetate (PubChem CID 142110693) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is ethane;prop-2-enyl 2-[(3-amino-2-hydroxyhexanoyl)amino]acetate.
| Compound Name | ethane;prop-2-enyl 2-[(3-amino-2-hydroxyhexanoyl)amino]acetate |
|---|---|
| PubChem CID | 142110693 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | ethane;prop-2-enyl 2-[(3-amino-2-hydroxyhexanoyl)amino]acetate |
| SMILES | C=CCOC(=O)CNC(=O)C(O)C(N)CCC.CC |
| InChI | InChI=1S/C11H20N2O4.C2H6/c1-3-5-8(12)10(15)11(16)13-7-9(14)17-6-4-2;1-2/h4,8,10,15H,2-3,5-7,12H2,1H3,(H,13,16);1-2H3 |
| InChIKey | MBONKTCBSFWHOC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|