C12H21NO4 — CID 143315572
prop-2-enyl 2-[(1-hydroxy-3-methyl-2-oxohexyl)amino]acetate (PubChem CID 143315572) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is prop-2-enyl 2-[(1-hydroxy-3-methyl-2-oxohexyl)amino]acetate.
| Compound Name | prop-2-enyl 2-[(1-hydroxy-3-methyl-2-oxohexyl)amino]acetate |
|---|---|
| PubChem CID | 143315572 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | prop-2-enyl 2-[(1-hydroxy-3-methyl-2-oxohexyl)amino]acetate |
| SMILES | C=CCOC(=O)CNC(O)C(=O)C(C)CCC |
| InChI | InChI=1S/C12H21NO4/c1-4-6-9(3)11(15)12(16)13-8-10(14)17-7-5-2/h5,9,12-13,16H,2,4,6-8H2,1,3H3 |
| InChIKey | LVZNRPKLFVXKOT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|