C12H23ClN2O4 — CID 89167264
butyl 2-[[3-(chloroamino)-2-hydroxyhexanoyl]amino]acetate (PubChem CID 89167264) has the molecular formula C12H23ClN2O4 and a molecular weight of 294.78 g/mol. Its IUPAC name is butyl 2-[[3-(chloroamino)-2-hydroxyhexanoyl]amino]acetate.
| Compound Name | butyl 2-[[3-(chloroamino)-2-hydroxyhexanoyl]amino]acetate |
|---|---|
| PubChem CID | 89167264 |
| Molecular Formula | C12H23ClN2O4 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | butyl 2-[[3-(chloroamino)-2-hydroxyhexanoyl]amino]acetate |
| SMILES | CCCCOC(=O)CNC(=O)C(O)C(CCC)NCl |
| InChI | InChI=1S/C12H23ClN2O4/c1-3-5-7-19-10(16)8-14-12(18)11(17)9(15-13)6-4-2/h9,11,15,17H,3-8H2,1-2H3,(H,14,18) |
| InChIKey | KAZGTSFZGDYTOR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|