C15H28N2O6 — CID 21016958
methyl 2-[[2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoyl]amino]acetate (PubChem CID 21016958) has the molecular formula C15H28N2O6 and a molecular weight of 332.40 g/mol. Its IUPAC name is methyl 2-[[2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoyl]amino]acetate.
| Compound Name | methyl 2-[[2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoyl]amino]acetate |
|---|---|
| PubChem CID | 21016958 |
| Molecular Formula | C15H28N2O6 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | methyl 2-[[2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoyl]amino]acetate |
| SMILES | CCCCC(NC(=O)OC(C)(C)C)C(O)C(=O)NCC(=O)OC |
| InChI | InChI=1S/C15H28N2O6/c1-6-7-8-10(17-14(21)23-15(2,3)4)12(19)13(20)16-9-11(18)22-5/h10,12,19H,6-9H2,1-5H3,(H,16,20)(H,17,21) |
| InChIKey | XDLLCVXIOICEQT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |