C10H21ClN2O2 — CID 139291082
3-amino-2-hydroxy-N-prop-2-enylheptanamide;hydrochloride (PubChem CID 139291082) has the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. Its IUPAC name is 3-amino-2-hydroxy-N-prop-2-enylheptanamide;hydrochloride.
| Compound Name | 3-amino-2-hydroxy-N-prop-2-enylheptanamide;hydrochloride |
|---|---|
| PubChem CID | 139291082 |
| Molecular Formula | C10H21ClN2O2 |
| Molecular Weight | 236.74 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3-amino-2-hydroxy-N-prop-2-enylheptanamide;hydrochloride |
| SMILES | C=CCNC(=O)C(O)C(N)CCCC.Cl |
| InChI | InChI=1S/C10H20N2O2.ClH/c1-3-5-6-8(11)9(13)10(14)12-7-4-2;/h4,8-9,13H,2-3,5-7,11H2,1H3,(H,12,14);1H |
| InChIKey | UYZOUDAFFFIMEY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.74 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|