C13H23NO — CID 143352205
5-methyl-2-(prop-2-enylamino)non-1-en-3-one (PubChem CID 143352205) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 5-methyl-2-(prop-2-enylamino)non-1-en-3-one.
| Compound Name | 5-methyl-2-(prop-2-enylamino)non-1-en-3-one |
|---|---|
| PubChem CID | 143352205 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 5-methyl-2-(prop-2-enylamino)non-1-en-3-one |
| SMILES | C=CCNC(=C)C(=O)CC(C)CCCC |
| InChI | InChI=1S/C13H23NO/c1-5-7-8-11(3)10-13(15)12(4)14-9-6-2/h6,11,14H,2,4-5,7-10H2,1,3H3 |
| InChIKey | MJRQDARGEONDLY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|