C11H22N2O — CID 115923519
2-(hexan-2-ylamino)-N-prop-2-enylacetamide (PubChem CID 115923519) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-(hexan-2-ylamino)-N-prop-2-enylacetamide.
| Compound Name | 2-(hexan-2-ylamino)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 115923519 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 2-(hexan-2-ylamino)-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CNC(C)CCCC |
| InChI | InChI=1S/C11H22N2O/c1-4-6-7-10(3)13-9-11(14)12-8-5-2/h5,10,13H,2,4,6-9H2,1,3H3,(H,12,14) |
| InChIKey | FZYHBWULOKNJGW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|