C9H7ClF5NO — CID 171263961
(2R,3R)-3-amino-3-(2-chloro-3,6-difluorophenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 171263961) has the molecular formula C9H7ClF5NO and a molecular weight of 275.60 g/mol. Its IUPAC name is (2R,3R)-3-amino-3-(2-chloro-3,6-difluorophenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2R,3R)-3-amino-3-(2-chloro-3,6-difluorophenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 171263961 |
| Molecular Formula | C9H7ClF5NO |
| Molecular Weight | 275.60 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | (2R,3R)-3-amino-3-(2-chloro-3,6-difluorophenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | N[C@H](c1c(F)ccc(F)c1Cl)[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C9H7ClF5NO/c10-6-4(12)2-1-3(11)5(6)7(16)8(17)9(13,14)15/h1-2,7-8,17H,16H2/t7-,8-/m1/s1 |
| InChIKey | ZZCAAKJVNXEJBZ-HTQZYQBOSA-N |
| XLogP | 2.54 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.60 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|