C9H10Cl2FNO — CID 130618254
(1S,2R)-1-amino-1-(2,6-dichloro-3-fluorophenyl)propan-2-ol (PubChem CID 130618254) has the molecular formula C9H10Cl2FNO and a molecular weight of 238.09 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(2,6-dichloro-3-fluorophenyl)propan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(2,6-dichloro-3-fluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 130618254 |
| Molecular Formula | C9H10Cl2FNO |
| Molecular Weight | 238.09 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | (1S,2R)-1-amino-1-(2,6-dichloro-3-fluorophenyl)propan-2-ol |
| SMILES | C[C@@H](O)[C@@H](N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C9H10Cl2FNO/c1-4(14)9(13)7-5(10)2-3-6(12)8(7)11/h2-4,9,14H,13H2,1H3/t4-,9-/m1/s1 |
| InChIKey | PHNSEFLLMXLALC-ALFREKQPSA-N |
| XLogP | 2.51 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.09 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|