C14H19Cl2F2NO — CID 171263957
(1S,2R)-2-amino-2-(2-chloro-3,6-difluorophenyl)-1-cyclohexylethanol;hydrochloride (PubChem CID 171263957) has the molecular formula C14H19Cl2F2NO and a molecular weight of 326.21 g/mol. Its IUPAC name is (1S,2R)-2-amino-2-(2-chloro-3,6-difluorophenyl)-1-cyclohexylethanol;hydrochloride.
| Compound Name | (1S,2R)-2-amino-2-(2-chloro-3,6-difluorophenyl)-1-cyclohexylethanol;hydrochloride |
|---|---|
| PubChem CID | 171263957 |
| Molecular Formula | C14H19Cl2F2NO |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | (1S,2R)-2-amino-2-(2-chloro-3,6-difluorophenyl)-1-cyclohexylethanol;hydrochloride |
| SMILES | Cl.N[C@H](c1c(F)ccc(F)c1Cl)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C14H18ClF2NO.ClH/c15-12-10(17)7-6-9(16)11(12)13(18)14(19)8-4-2-1-3-5-8;/h6-8,13-14,19H,1-5,18H2;1H/t13-,14+;/m1./s1 |
| InChIKey | HWLWXCPPCMVAOW-DFQHDRSWSA-N |
| XLogP | 3.98 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|