C12H14F2O — CID 63894572
cyclopentyl-(2,3-difluorophenyl)methanol (PubChem CID 63894572) has the molecular formula C12H14F2O and a molecular weight of 212.24 g/mol. Its IUPAC name is cyclopentyl-(2,3-difluorophenyl)methanol.
| Compound Name | cyclopentyl-(2,3-difluorophenyl)methanol |
|---|---|
| PubChem CID | 63894572 |
| Molecular Formula | C12H14F2O |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | cyclopentyl-(2,3-difluorophenyl)methanol |
| SMILES | OC(c1cccc(F)c1F)C1CCCC1 |
| InChI | InChI=1S/C12H14F2O/c13-10-7-3-6-9(11(10)14)12(15)8-4-1-2-5-8/h3,6-8,12,15H,1-2,4-5H2 |
| InChIKey | FUDMOCJMPMXSIF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |