C11H11F3O — CID 64986364
cyclobutyl-(2,3,4-trifluorophenyl)methanol (PubChem CID 64986364) has the molecular formula C11H11F3O and a molecular weight of 216.20 g/mol. Its IUPAC name is cyclobutyl-(2,3,4-trifluorophenyl)methanol.
| Compound Name | cyclobutyl-(2,3,4-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 64986364 |
| Molecular Formula | C11H11F3O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | cyclobutyl-(2,3,4-trifluorophenyl)methanol |
| SMILES | OC(c1ccc(F)c(F)c1F)C1CCC1 |
| InChI | InChI=1S/C11H11F3O/c12-8-5-4-7(9(13)10(8)14)11(15)6-2-1-3-6/h4-6,11,15H,1-3H2 |
| InChIKey | KQFDNRLSSVSFDK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|