C14H18F3N — CID 65399083
cycloheptyl-(2,3,4-trifluorophenyl)methanamine (PubChem CID 65399083) has the molecular formula C14H18F3N and a molecular weight of 257.30 g/mol. Its IUPAC name is cycloheptyl-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | cycloheptyl-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 65399083 |
| Molecular Formula | C14H18F3N |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | cycloheptyl-(2,3,4-trifluorophenyl)methanamine |
| SMILES | NC(c1ccc(F)c(F)c1F)C1CCCCCC1 |
| InChI | InChI=1S/C14H18F3N/c15-11-8-7-10(12(16)13(11)17)14(18)9-5-3-1-2-4-6-9/h7-9,14H,1-6,18H2 |
| InChIKey | ORIQUDRMSVWVOI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|