C12H14F3NS — CID 80626778
thian-2-yl-(2,3,4-trifluorophenyl)methanamine (PubChem CID 80626778) has the molecular formula C12H14F3NS and a molecular weight of 261.31 g/mol. Its IUPAC name is thian-2-yl-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | thian-2-yl-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 80626778 |
| Molecular Formula | C12H14F3NS |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | thian-2-yl-(2,3,4-trifluorophenyl)methanamine |
| SMILES | NC(c1ccc(F)c(F)c1F)C1CCCCS1 |
| InChI | InChI=1S/C12H14F3NS/c13-8-5-4-7(10(14)11(8)15)12(16)9-3-1-2-6-17-9/h4-5,9,12H,1-3,6,16H2 |
| InChIKey | RAQXXTLUHJFUGO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|