C13H16F3NS — CID 80622741
N-[thiolan-2-yl-(2,3,4-trifluorophenyl)methyl]ethanamine (PubChem CID 80622741) has the molecular formula C13H16F3NS and a molecular weight of 275.34 g/mol. Its IUPAC name is N-[thiolan-2-yl-(2,3,4-trifluorophenyl)methyl]ethanamine.
| Compound Name | N-[thiolan-2-yl-(2,3,4-trifluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 80622741 |
| Molecular Formula | C13H16F3NS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N-[thiolan-2-yl-(2,3,4-trifluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(F)c(F)c1F)C1CCCS1 |
| InChI | InChI=1S/C13H16F3NS/c1-2-17-13(10-4-3-7-18-10)8-5-6-9(14)12(16)11(8)15/h5-6,10,13,17H,2-4,7H2,1H3 |
| InChIKey | USSGFZLDHBBCDL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|