C16H22F3N — CID 63415395
N-[(4-methylcyclohexyl)-(2,3,4-trifluorophenyl)methyl]ethanamine (PubChem CID 63415395) has the molecular formula C16H22F3N and a molecular weight of 285.35 g/mol. Its IUPAC name is N-[(4-methylcyclohexyl)-(2,3,4-trifluorophenyl)methyl]ethanamine.
| Compound Name | N-[(4-methylcyclohexyl)-(2,3,4-trifluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 63415395 |
| Molecular Formula | C16H22F3N |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-[(4-methylcyclohexyl)-(2,3,4-trifluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(F)c(F)c1F)C1CCC(C)CC1 |
| InChI | InChI=1S/C16H22F3N/c1-3-20-16(11-6-4-10(2)5-7-11)12-8-9-13(17)15(19)14(12)18/h8-11,16,20H,3-7H2,1-2H3 |
| InChIKey | CGOBREOOPLESIL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|