C15H20F3NS — CID 105146575
N-ethyl-2-(thian-4-yl)-1-(2,3,4-trifluorophenyl)ethanamine (PubChem CID 105146575) has the molecular formula C15H20F3NS and a molecular weight of 303.39 g/mol. Its IUPAC name is N-ethyl-2-(thian-4-yl)-1-(2,3,4-trifluorophenyl)ethanamine.
| Compound Name | N-ethyl-2-(thian-4-yl)-1-(2,3,4-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 105146575 |
| Molecular Formula | C15H20F3NS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-ethyl-2-(thian-4-yl)-1-(2,3,4-trifluorophenyl)ethanamine |
| SMILES | CCNC(CC1CCSCC1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H20F3NS/c1-2-19-13(9-10-5-7-20-8-6-10)11-3-4-12(16)15(18)14(11)17/h3-4,10,13,19H,2,5-9H2,1H3 |
| InChIKey | HMKOSKDSHKDKFJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|