C16H23ClFN — CID 63418000
1-(4-chloro-2-fluorophenyl)-2-cyclohexyl-N-ethylethanamine (PubChem CID 63418000) has the molecular formula C16H23ClFN and a molecular weight of 283.82 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-2-cyclohexyl-N-ethylethanamine.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-2-cyclohexyl-N-ethylethanamine |
|---|---|
| PubChem CID | 63418000 |
| Molecular Formula | C16H23ClFN |
| Molecular Weight | 283.82 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-2-cyclohexyl-N-ethylethanamine |
| SMILES | CCNC(CC1CCCCC1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C16H23ClFN/c1-2-19-16(10-12-6-4-3-5-7-12)14-9-8-13(17)11-15(14)18/h8-9,11-12,16,19H,2-7,10H2,1H3 |
| InChIKey | OZDWISOCBOGXQI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.82 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |