C16H24ClN — CID 106857386
1-(2-chloro-4-methylphenyl)-2-cyclopentyl-N-ethylethanamine (PubChem CID 106857386) has the molecular formula C16H24ClN and a molecular weight of 265.83 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-2-cyclopentyl-N-ethylethanamine.
| Compound Name | 1-(2-chloro-4-methylphenyl)-2-cyclopentyl-N-ethylethanamine |
|---|---|
| PubChem CID | 106857386 |
| Molecular Formula | C16H24ClN |
| Molecular Weight | 265.83 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-2-cyclopentyl-N-ethylethanamine |
| SMILES | CCNC(CC1CCCC1)c1ccc(C)cc1Cl |
| InChI | InChI=1S/C16H24ClN/c1-3-18-16(11-13-6-4-5-7-13)14-9-8-12(2)10-15(14)17/h8-10,13,16,18H,3-7,11H2,1-2H3 |
| InChIKey | CEGMSDLEFFCWTQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.83 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |