C17H24BrF2N — CID 107539192
N-[(2-bromo-3,4-difluorophenyl)-(4-ethylcyclohexyl)methyl]ethanamine (PubChem CID 107539192) has the molecular formula C17H24BrF2N and a molecular weight of 360.29 g/mol. Its IUPAC name is N-[(2-bromo-3,4-difluorophenyl)-(4-ethylcyclohexyl)methyl]ethanamine.
| Compound Name | N-[(2-bromo-3,4-difluorophenyl)-(4-ethylcyclohexyl)methyl]ethanamine |
|---|---|
| PubChem CID | 107539192 |
| Molecular Formula | C17H24BrF2N |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-[(2-bromo-3,4-difluorophenyl)-(4-ethylcyclohexyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(F)c(F)c1Br)C1CCC(CC)CC1 |
| InChI | InChI=1S/C17H24BrF2N/c1-3-11-5-7-12(8-6-11)17(21-4-2)13-9-10-14(19)16(20)15(13)18/h9-12,17,21H,3-8H2,1-2H3 |
| InChIKey | HPAUNTFPFLUCQV-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|